C23H25NO — CID 137445709
2-(3,3-dimethyl-1,2,7,8,9,10-hexahydrobenzo[f]chromen-8-yl)-5-methylbenzonitrile (PubChem CID 137445709) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-(3,3-dimethyl-1,2,7,8,9,10-hexahydrobenzo[f]chromen-8-yl)-5-methylbenzonitrile.
| Compound Name | 2-(3,3-dimethyl-1,2,7,8,9,10-hexahydrobenzo[f]chromen-8-yl)-5-methylbenzonitrile |
|---|---|
| PubChem CID | 137445709 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-(3,3-dimethyl-1,2,7,8,9,10-hexahydrobenzo[f]chromen-8-yl)-5-methylbenzonitrile |
| SMILES | Cc1ccc(C2CCc3c(ccc4c3CCC(C)(C)O4)C2)c(C#N)c1 |
| InChI | InChI=1S/C23H25NO/c1-15-4-7-19(18(12-15)14-24)16-5-8-20-17(13-16)6-9-22-21(20)10-11-23(2,3)25-22/h4,6-7,9,12,16H,5,8,10-11,13H2,1-3H3 |
| InChIKey | PTDRWQNAXOTKKR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |