C39H40N2 — CID 137446398
3-methyl-N-[4-[(2Z,4E)-4-(N-(3-methylphenyl)anilino)hepta-2,4-dienyl]cyclohexa-2,4-dien-1-yl]-N-phenylaniline (PubChem CID 137446398) has the molecular formula C39H40N2 and a molecular weight of 536.76 g/mol. Its IUPAC name is 3-methyl-N-[4-[(2Z,4E)-4-(N-(3-methylphenyl)anilino)hepta-2,4-dienyl]cyclohexa-2,4-dien-1-yl]-N-phenylaniline.
| Compound Name | 3-methyl-N-[4-[(2Z,4E)-4-(N-(3-methylphenyl)anilino)hepta-2,4-dienyl]cyclohexa-2,4-dien-1-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 137446398 |
| Molecular Formula | C39H40N2 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | 3-methyl-N-[4-[(2Z,4E)-4-(N-(3-methylphenyl)anilino)hepta-2,4-dienyl]cyclohexa-2,4-dien-1-yl]-N-phenylaniline |
| SMILES | CC/C=C(\C=C/CC1=CCC(N(c2ccccc2)c2cccc(C)c2)C=C1)N(c1ccccc1)c1cccc(C)c1 |
| InChI | InChI=1S/C39H40N2/c1-4-14-34(40(35-18-7-5-8-19-35)38-23-11-15-31(2)29-38)22-13-17-33-25-27-37(28-26-33)41(36-20-9-6-10-21-36)39-24-12-16-32(3)30-39/h5-16,18-27,29-30,37H,4,17,28H2,1-3H3/b22-13-,34-14+ |
| InChIKey | OJIJMUKBZPATSZ-LMMBGAHESA-N |
| XLogP | 10.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|