About [4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate
[4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate (PubChem CID 137452818) has the molecular formula C21H21IO4
and a molecular weight of 464.30 g/mol. Its IUPAC name is [4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate.
Molecular Properties
| Compound Name | [4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate |
| PubChem CID | 137452818 |
| Molecular Formula | C21H21IO4 |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | [4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate |
| SMILES | CCC(I)C(=O)Oc1ccc(OC2(c3cc4ccc3o4)CCCC2)cc1 |
| InChI | InChI=1S/C21H21IO4/c1-2-18(22)20(23)25-14-5-7-15(8-6-14)26-21(11-3-4-12-21)17-13-16-9-10-19(17)24-16/h5-10,13,18H,2-4,11-12H2,1H3 |
| InChIKey | LUYOMDAOYXOFKZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate?
The IUPAC name of [4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate (CID 137452818) is [4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate.
What is the SMILES notation for [4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate?
The canonical SMILES for [4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate is CCC(I)C(=O)Oc1ccc(OC2(c3cc4ccc3o4)CCCC2)cc1.
What is the InChIKey of [4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate?
The InChIKey is LUYOMDAOYXOFKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21IO4/c1-2-18(22)20(23)25-14-5-7-15(8-6-14)26-21(11-3-4-12-21)17-13-16-9-10-19(17)24-16/h5-10,13,18H,2-4,11-12H2,1H3.
What are the key properties of [4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate?
[4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate has a molecular weight of 464.30 g/mol, XLogP of 5.84, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)cyclopentyl]oxyphenyl] 2-iodobutanoate is sourced from PubChem (CID 137452818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).