C25H20N4O6S2 — CID 137463378
N-[5-(4-cyano-2-methoxyphenoxy)-4-(4-propoxyphenyl)-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide (PubChem CID 137463378) has the molecular formula C25H20N4O6S2 and a molecular weight of 536.59 g/mol. Its IUPAC name is N-[5-(4-cyano-2-methoxyphenoxy)-4-(4-propoxyphenyl)-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[5-(4-cyano-2-methoxyphenoxy)-4-(4-propoxyphenyl)-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 137463378 |
| Molecular Formula | C25H20N4O6S2 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | N-[5-(4-cyano-2-methoxyphenoxy)-4-(4-propoxyphenyl)-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide |
| SMILES | CCCOc1ccc(-c2nc(NC(=O)c3ccc([N+](=O)[O-])s3)sc2Oc2ccc(C#N)cc2OC)cc1 |
| InChI | InChI=1S/C25H20N4O6S2/c1-3-12-34-17-7-5-16(6-8-17)22-24(35-18-9-4-15(14-26)13-19(18)33-2)37-25(27-22)28-23(30)20-10-11-21(36-20)29(31)32/h4-11,13H,3,12H2,1-2H3,(H,27,28,30) |
| InChIKey | BORVFRWJDDLOGS-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 136.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|