C24H21N3O4S2 — CID 146592926
N-[4-(4-tert-butylphenyl)-5-phenoxy-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide (PubChem CID 146592926) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-[4-(4-tert-butylphenyl)-5-phenoxy-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[4-(4-tert-butylphenyl)-5-phenoxy-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 146592926 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | N-[4-(4-tert-butylphenyl)-5-phenoxy-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(-c2nc(NC(=O)c3ccc([N+](=O)[O-])s3)sc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O4S2/c1-24(2,3)16-11-9-15(10-12-16)20-22(31-17-7-5-4-6-8-17)33-23(25-20)26-21(28)18-13-14-19(32-18)27(29)30/h4-14H,1-3H3,(H,25,26,28) |
| InChIKey | KVEOYVOZMWQXCE-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|