C23H16F3N3O4S2 — CID 137463419
N-[4-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide (PubChem CID 137463419) has the molecular formula C23H16F3N3O4S2 and a molecular weight of 519.53 g/mol. Its IUPAC name is N-[4-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[4-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 137463419 |
| Molecular Formula | C23H16F3N3O4S2 |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | N-[4-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide |
| SMILES | CCOc1ccc(-c2nc(NC(=O)c3ccc([N+](=O)[O-])s3)sc2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H16F3N3O4S2/c1-2-33-16-9-5-13(6-10-16)19-20(14-3-7-15(8-4-14)23(24,25)26)35-22(27-19)28-21(30)17-11-12-18(34-17)29(31)32/h3-12H,2H2,1H3,(H,27,28,30) |
| InChIKey | HUKCOHDJEAQBGM-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|