C26H25N3O5S2 — CID 137463829
N-[4-(4-butoxyphenyl)-5-(3,5-dimethylphenoxy)-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide (PubChem CID 137463829) has the molecular formula C26H25N3O5S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is N-[4-(4-butoxyphenyl)-5-(3,5-dimethylphenoxy)-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[4-(4-butoxyphenyl)-5-(3,5-dimethylphenoxy)-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 137463829 |
| Molecular Formula | C26H25N3O5S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | N-[4-(4-butoxyphenyl)-5-(3,5-dimethylphenoxy)-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide |
| SMILES | CCCCOc1ccc(-c2nc(NC(=O)c3ccc([N+](=O)[O-])s3)sc2Oc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C26H25N3O5S2/c1-4-5-12-33-19-8-6-18(7-9-19)23-25(34-20-14-16(2)13-17(3)15-20)36-26(27-23)28-24(30)21-10-11-22(35-21)29(31)32/h6-11,13-15H,4-5,12H2,1-3H3,(H,27,28,30) |
| InChIKey | CEWSZODDYSBFFT-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|