C24H18F3N3O6S2 — CID 137463405
5-nitro-N-[4-(4-propoxyphenyl)-5-[4-(trifluoromethoxy)phenoxy]-1,3-thiazol-2-yl]thiophene-2-carboxamide (PubChem CID 137463405) has the molecular formula C24H18F3N3O6S2 and a molecular weight of 565.55 g/mol. Its IUPAC name is 5-nitro-N-[4-(4-propoxyphenyl)-5-[4-(trifluoromethoxy)phenoxy]-1,3-thiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-nitro-N-[4-(4-propoxyphenyl)-5-[4-(trifluoromethoxy)phenoxy]-1,3-thiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 137463405 |
| Molecular Formula | C24H18F3N3O6S2 |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | 5-nitro-N-[4-(4-propoxyphenyl)-5-[4-(trifluoromethoxy)phenoxy]-1,3-thiazol-2-yl]thiophene-2-carboxamide |
| SMILES | CCCOc1ccc(-c2nc(NC(=O)c3ccc([N+](=O)[O-])s3)sc2Oc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H18F3N3O6S2/c1-2-13-34-15-5-3-14(4-6-15)20-22(35-16-7-9-17(10-8-16)36-24(25,26)27)38-23(28-20)29-21(31)18-11-12-19(37-18)30(32)33/h3-12H,2,13H2,1H3,(H,28,29,31) |
| InChIKey | QNIJSQBXYBIFQD-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|