C24H21N3O6S2 — CID 137463830
N-[4-(2,4-diethoxyphenyl)-5-phenoxy-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide (PubChem CID 137463830) has the molecular formula C24H21N3O6S2 and a molecular weight of 511.58 g/mol. Its IUPAC name is N-[4-(2,4-diethoxyphenyl)-5-phenoxy-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[4-(2,4-diethoxyphenyl)-5-phenoxy-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 137463830 |
| Molecular Formula | C24H21N3O6S2 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | N-[4-(2,4-diethoxyphenyl)-5-phenoxy-1,3-thiazol-2-yl]-5-nitrothiophene-2-carboxamide |
| SMILES | CCOc1ccc(-c2nc(NC(=O)c3ccc([N+](=O)[O-])s3)sc2Oc2ccccc2)c(OCC)c1 |
| InChI | InChI=1S/C24H21N3O6S2/c1-3-31-16-10-11-17(18(14-16)32-4-2)21-23(33-15-8-6-5-7-9-15)35-24(25-21)26-22(28)19-12-13-20(34-19)27(29)30/h5-14H,3-4H2,1-2H3,(H,25,26,28) |
| InChIKey | SBCXUHBABJPYBX-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|