C19H36NO10P — CID 137475744
[1-[methoxy-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phosphoryl]oxy-3-propanoyloxypropan-2-yl] 3-methylbutanoate (PubChem CID 137475744) has the molecular formula C19H36NO10P and a molecular weight of 469.47 g/mol. Its IUPAC name is [1-[methoxy-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phosphoryl]oxy-3-propanoyloxypropan-2-yl] 3-methylbutanoate.
| Compound Name | [1-[methoxy-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phosphoryl]oxy-3-propanoyloxypropan-2-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 137475744 |
| Molecular Formula | C19H36NO10P |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | [1-[methoxy-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phosphoryl]oxy-3-propanoyloxypropan-2-yl] 3-methylbutanoate |
| SMILES | CCC(=O)OCC(COP(=O)(OC)OCCNC(=O)OC(C)(C)C)OC(=O)CC(C)C |
| InChI | InChI=1S/C19H36NO10P/c1-8-16(21)26-12-15(29-17(22)11-14(2)3)13-28-31(24,25-7)27-10-9-20-18(23)30-19(4,5)6/h14-15H,8-13H2,1-7H3,(H,20,23) |
| InChIKey | ULMGHMOXXLYSJW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|