C13H16ClNO6S — CID 138001391
3-chloro-5-[3-(2-methoxyethoxy)azetidin-1-yl]sulfonylbenzoic acid (PubChem CID 138001391) has the molecular formula C13H16ClNO6S and a molecular weight of 349.79 g/mol. Its IUPAC name is 3-chloro-5-[3-(2-methoxyethoxy)azetidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 3-chloro-5-[3-(2-methoxyethoxy)azetidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 138001391 |
| Molecular Formula | C13H16ClNO6S |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 3-chloro-5-[3-(2-methoxyethoxy)azetidin-1-yl]sulfonylbenzoic acid |
| SMILES | COCCOC1CN(S(=O)(=O)c2cc(Cl)cc(C(=O)O)c2)C1 |
| InChI | InChI=1S/C13H16ClNO6S/c1-20-2-3-21-11-7-15(8-11)22(18,19)12-5-9(13(16)17)4-10(14)6-12/h4-6,11H,2-3,7-8H2,1H3,(H,16,17) |
| InChIKey | BHEUJQJJPREGHU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|