C7H9NO6S2 — CID 138008020
3,4-dimethoxy-5-sulfamoylthiophene-2-carboxylic acid (PubChem CID 138008020) has the molecular formula C7H9NO6S2 and a molecular weight of 267.28 g/mol. Its IUPAC name is 3,4-dimethoxy-5-sulfamoylthiophene-2-carboxylic acid.
| Compound Name | 3,4-dimethoxy-5-sulfamoylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 138008020 |
| Molecular Formula | C7H9NO6S2 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 3,4-dimethoxy-5-sulfamoylthiophene-2-carboxylic acid |
| SMILES | COc1c(C(=O)O)sc(S(N)(=O)=O)c1OC |
| InChI | InChI=1S/C7H9NO6S2/c1-13-3-4(14-2)7(16(8,11)12)15-5(3)6(9)10/h1-2H3,(H,9,10)(H2,8,11,12) |
| InChIKey | OZORAJJZNXBTLC-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |