C34H62NO7P — CID 138291861
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] heptanoate (PubChem CID 138291861) has the molecular formula C34H62NO7P and a molecular weight of 627.84 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] heptanoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] heptanoate |
|---|---|
| PubChem CID | 138291861 |
| Molecular Formula | C34H62NO7P |
| Molecular Weight | 627.84 g/mol |
| Exact Mass | 627.43 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] heptanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCCOCC(COP(=O)(O)OCCN)OC(=O)CCCCCC |
| InChI | InChI=1S/C34H62NO7P/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26-29-39-31-33(32-41-43(37,38)40-30-28-35)42-34(36)27-25-8-6-4-2/h5,7,10-11,13-14,16-17,33H,3-4,6,8-9,12,15,18-32,35H2,1-2H3,(H,37,38)/b7-5-,11-10-,14-13-,17-16- |
| InChIKey | WTYSSMVZEZAWEQ-ZRENGBSJSA-N |
| XLogP | 8.90 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.84 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|