C15H15F7N4O3 — CID 138375152
1-[1-[2-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-hydroxy-3-(trifluoromethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 138375152) has the molecular formula C15H15F7N4O3 and a molecular weight of 432.30 g/mol. Its IUPAC name is 1-[1-[2-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-hydroxy-3-(trifluoromethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 1-[1-[2-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-hydroxy-3-(trifluoromethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 138375152 |
| Molecular Formula | C15H15F7N4O3 |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 1-[1-[2-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-6-hydroxy-3-(trifluoromethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | CC(c1ccc(OC(F)(F)F)cc1F)N1NC(C(F)(F)F)C2C(=O)NC(O)NC21 |
| InChI | InChI=1S/C15H15F7N4O3/c1-5(7-3-2-6(4-8(7)16)29-15(20,21)22)26-11-9(10(25-26)14(17,18)19)12(27)24-13(28)23-11/h2-5,9-11,13,23,25,28H,1H3,(H,24,27) |
| InChIKey | BBHXASXJNLQSSA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |