C17H21F6N5O — CID 138375168
6-(dimethylamino)-3-(trifluoromethyl)-1-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 138375168) has the molecular formula C17H21F6N5O and a molecular weight of 425.38 g/mol. Its IUPAC name is 6-(dimethylamino)-3-(trifluoromethyl)-1-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-(dimethylamino)-3-(trifluoromethyl)-1-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 138375168 |
| Molecular Formula | C17H21F6N5O |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 6-(dimethylamino)-3-(trifluoromethyl)-1-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | C[C@@H](c1ccc(C(F)(F)F)cc1)N1NC(C(F)(F)F)C2C(=O)NC(N(C)C)NC21 |
| InChI | InChI=1S/C17H21F6N5O/c1-8(9-4-6-10(7-5-9)16(18,19)20)28-13-11(12(26-28)17(21,22)23)14(29)25-15(24-13)27(2)3/h4-8,11-13,15,24,26H,1-3H3,(H,25,29)/t8-,11?,12?,13?,15?/m0/s1 |
| InChIKey | RTNFRKOIWHZXEO-QPZLDLQTSA-N |
| XLogP | 2.02 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |