C16H19F5N4O2 — CID 138375141
3-(2,2-difluoroethyl)-6-hydroxy-1-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 138375141) has the molecular formula C16H19F5N4O2 and a molecular weight of 394.34 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-6-hydroxy-1-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 3-(2,2-difluoroethyl)-6-hydroxy-1-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 138375141 |
| Molecular Formula | C16H19F5N4O2 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 3-(2,2-difluoroethyl)-6-hydroxy-1-[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | C[C@@H](c1ccc(C(F)(F)F)cc1)N1NC(CC(F)F)C2C(=O)NC(O)NC21 |
| InChI | InChI=1S/C16H19F5N4O2/c1-7(8-2-4-9(5-3-8)16(19,20)21)25-13-12(10(24-25)6-11(17)18)14(26)23-15(27)22-13/h2-5,7,10-13,15,22,24,27H,6H2,1H3,(H,23,26)/t7-,10?,12?,13?,15?/m0/s1 |
| InChIKey | XJJQJBVQIBSHTD-DZLZGTBZSA-N |
| XLogP | 1.55 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |