C17H24F3N5O — CID 138375129
6-(dimethylamino)-3-methyl-1-[1-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 138375129) has the molecular formula C17H24F3N5O and a molecular weight of 371.41 g/mol. Its IUPAC name is 6-(dimethylamino)-3-methyl-1-[1-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-(dimethylamino)-3-methyl-1-[1-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 138375129 |
| Molecular Formula | C17H24F3N5O |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 6-(dimethylamino)-3-methyl-1-[1-[4-(trifluoromethyl)phenyl]ethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | CC1NN(C(C)c2ccc(C(F)(F)F)cc2)C2NC(N(C)C)NC(=O)C12 |
| InChI | InChI=1S/C17H24F3N5O/c1-9-13-14(21-16(24(3)4)22-15(13)26)25(23-9)10(2)11-5-7-12(8-6-11)17(18,19)20/h5-10,13-14,16,21,23H,1-4H3,(H,22,26) |
| InChIKey | UUHYBBYHKGATQQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |