C17H20F6N4O2 — CID 138375165
6-hydroxy-1-[2-methyl-1-[4-(trifluoromethyl)phenyl]propyl]-3-(trifluoromethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 138375165) has the molecular formula C17H20F6N4O2 and a molecular weight of 426.36 g/mol. Its IUPAC name is 6-hydroxy-1-[2-methyl-1-[4-(trifluoromethyl)phenyl]propyl]-3-(trifluoromethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-hydroxy-1-[2-methyl-1-[4-(trifluoromethyl)phenyl]propyl]-3-(trifluoromethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 138375165 |
| Molecular Formula | C17H20F6N4O2 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 6-hydroxy-1-[2-methyl-1-[4-(trifluoromethyl)phenyl]propyl]-3-(trifluoromethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | CC(C)C(c1ccc(C(F)(F)F)cc1)N1NC(C(F)(F)F)C2C(=O)NC(O)NC21 |
| InChI | InChI=1S/C17H20F6N4O2/c1-7(2)11(8-3-5-9(6-4-8)16(18,19)20)27-13-10(12(26-27)17(21,22)23)14(28)25-15(29)24-13/h3-7,10-13,15,24,26,29H,1-2H3,(H,25,28) |
| InChIKey | PPXKQPWGLAMKPR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |