C17H29NP+ — CID 138375799
[2-(dimethylamino)-2,3,3a,7a-tetrahydroinden-1-ylidene]-di(propan-2-yl)phosphanium (PubChem CID 138375799) has the molecular formula C17H29NP+ and a molecular weight of 278.40 g/mol. Its IUPAC name is [2-(dimethylamino)-2,3,3a,7a-tetrahydroinden-1-ylidene]-di(propan-2-yl)phosphanium.
| Compound Name | [2-(dimethylamino)-2,3,3a,7a-tetrahydroinden-1-ylidene]-di(propan-2-yl)phosphanium |
|---|---|
| PubChem CID | 138375799 |
| Molecular Formula | C17H29NP+ |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | [2-(dimethylamino)-2,3,3a,7a-tetrahydroinden-1-ylidene]-di(propan-2-yl)phosphanium |
| SMILES | CC(C)[P+](=C1C2C=CC=CC2CC1N(C)C)C(C)C |
| InChI | InChI=1S/C17H29NP/c1-12(2)19(13(3)4)17-15-10-8-7-9-14(15)11-16(17)18(5)6/h7-10,12-16H,11H2,1-6H3/q+1 |
| InChIKey | ZQEVYEZKHACQMI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|