C13H14ClN3O4S — CID 138376703
N-(4-chloro-2,5-dimethoxyphenyl)-2-imino-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 138376703) has the molecular formula C13H14ClN3O4S and a molecular weight of 343.79 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-imino-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-imino-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 138376703 |
| Molecular Formula | C13H14ClN3O4S |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-imino-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | [H]/N=C1/NC(=O)CC(C(=O)Nc2cc(OC)c(Cl)cc2OC)S1 |
| InChI | InChI=1S/C13H14ClN3O4S/c1-20-8-4-7(9(21-2)3-6(8)14)16-12(19)10-5-11(18)17-13(15)22-10/h3-4,10H,5H2,1-2H3,(H,16,19)(H2,15,17,18) |
| InChIKey | KEHCTSRWUSOSHI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|