C15H19ClN2O4S — CID 138383287
(3aR,7aS)-2-(5-chloro-2-methoxyphenyl)sulfonyl-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 138383287) has the molecular formula C15H19ClN2O4S and a molecular weight of 358.85 g/mol. Its IUPAC name is (3aR,7aS)-2-(5-chloro-2-methoxyphenyl)sulfonyl-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aR,7aS)-2-(5-chloro-2-methoxyphenyl)sulfonyl-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 138383287 |
| Molecular Formula | C15H19ClN2O4S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | (3aR,7aS)-2-(5-chloro-2-methoxyphenyl)sulfonyl-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1C[C@H]2CCN(C)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C15H19ClN2O4S/c1-17-6-5-10-8-18(9-12(10)15(17)19)23(20,21)14-7-11(16)3-4-13(14)22-2/h3-4,7,10,12H,5-6,8-9H2,1-2H3/t10-,12+/m1/s1 |
| InChIKey | KWVZCWMSEHTWBD-PWSUYJOCSA-N |
| XLogP | 1.45 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |