C14H17ClN2O5S2 — CID 146210987
N-[3-(5-chloro-2-methoxyphenyl)sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]ethenesulfonamide (PubChem CID 146210987) has the molecular formula C14H17ClN2O5S2 and a molecular weight of 392.89 g/mol. Its IUPAC name is N-[3-(5-chloro-2-methoxyphenyl)sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]ethenesulfonamide.
| Compound Name | N-[3-(5-chloro-2-methoxyphenyl)sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 146210987 |
| Molecular Formula | C14H17ClN2O5S2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N-[3-(5-chloro-2-methoxyphenyl)sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NC1C2CN(S(=O)(=O)c3cc(Cl)ccc3OC)CC21 |
| InChI | InChI=1S/C14H17ClN2O5S2/c1-3-23(18,19)16-14-10-7-17(8-11(10)14)24(20,21)13-6-9(15)4-5-12(13)22-2/h3-6,10-11,14,16H,1,7-8H2,2H3 |
| InChIKey | XTXONAIECQHGSH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |