C16H23N2NaO5 — CID 138401262
sodium 1-(2-ethoxy-2-oxoethyl)-5-(3-methylbutyl)-2,6-dioxo-5-prop-2-enylpyrimidin-4-olate (PubChem CID 138401262) has the molecular formula C16H23N2NaO5 and a molecular weight of 346.36 g/mol. Its IUPAC name is sodium 1-(2-ethoxy-2-oxoethyl)-5-(3-methylbutyl)-2,6-dioxo-5-prop-2-enylpyrimidin-4-olate.
| Compound Name | sodium 1-(2-ethoxy-2-oxoethyl)-5-(3-methylbutyl)-2,6-dioxo-5-prop-2-enylpyrimidin-4-olate |
|---|---|
| PubChem CID | 138401262 |
| Molecular Formula | C16H23N2NaO5 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | sodium 1-(2-ethoxy-2-oxoethyl)-5-(3-methylbutyl)-2,6-dioxo-5-prop-2-enylpyrimidin-4-olate |
| SMILES | C=CCC1(CCC(C)C)C(=O)N(CC(=O)OCC)C(=O)N=C1[O-].[Na+] |
| InChI | InChI=1S/C16H24N2O5.Na/c1-5-8-16(9-7-11(3)4)13(20)17-15(22)18(14(16)21)10-12(19)23-6-2;/h5,11H,1,6-10H2,2-4H3,(H,17,20,22);/q;+1/p-1 |
| InChIKey | ARRVJHZJPLJDGF-UHFFFAOYSA-M |
| XLogP | -1.73 |
| TPSA | 99.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|