C84H110N4O8 — CID 138455535
5,10,15,20-tetrakis[3,5-bis(2-methylbutoxy)phenyl]-21,23-dihydroporphyrin (PubChem CID 138455535) has the molecular formula C84H110N4O8 and a molecular weight of 1303.82 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[3,5-bis(2-methylbutoxy)phenyl]-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[3,5-bis(2-methylbutoxy)phenyl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 138455535 |
| Molecular Formula | C84H110N4O8 |
| Molecular Weight | 1303.82 g/mol |
| Exact Mass | 1302.83 |
| IUPAC Name | 5,10,15,20-tetrakis[3,5-bis(2-methylbutoxy)phenyl]-21,23-dihydroporphyrin |
| SMILES | CCC(C)COc1cc(OCC(C)CC)cc(-c2c3nc(c(-c4cc(OCC(C)CC)cc(OCC(C)CC)c4)c4ccc([nH]4)c(-c4cc(OCC(C)CC)cc(OCC(C)CC)c4)c4nc(c(-c5cc(OCC(C)CC)cc(OCC(C)CC)c5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C84H110N4O8/c1-17-53(9)45-89-65-33-61(34-66(41-65)90-46-54(10)18-2)81-73-25-27-75(85-73)82(62-35-67(91-47-55(11)19-3)42-68(36-62)92-48-56(12)20-4)77-29-31-79(87-77)84(64-39-71(95-51-59(15)23-7)44-72(40-64)96-52-60(16)24-8)80-32-30-78(88-80)83(76-28-26-74(81)86-76)63-37-69(93-49-57(13)21-5)43-70(38-63)94-50-58(14)22-6/h25-44,53-60,85,88H,17-24,45-52H2,1-16H3/b81-73-,81-74-,82-75-,82-77-,83-76-,83-78-,84-79-,84-80- |
| InChIKey | YVGRIJWQRVULKG-QOXVGFMUSA-N |
| XLogP | 22.72 |
| TPSA | 131.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1303.82 |
| LogP ≤ 5 | 22.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |