C22H25F4N6O3S- — CID 138459311
CID 138459311 (PubChem CID 138459311) has the molecular formula C22H25F4N6O3S- and a molecular weight of 529.54 g/mol.
| Compound Name | CID 138459311 |
|---|---|
| PubChem CID | 138459311 |
| Molecular Formula | C22H25F4N6O3S- |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | — |
| SMILES | CC(C)(/N=C(\N)N1CCCCN=[S-]1=O)c1cc(NC(=O)c2ccc(OCC(F)(F)F)cn2)ccc1F |
| InChI | InChI=1S/C22H25F4N6O3S/c1-21(2,31-20(27)32-10-4-3-9-29-36(32)34)16-11-14(5-7-17(16)23)30-19(33)18-8-6-15(12-28-18)35-13-22(24,25)26/h5-8,11-12H,3-4,9-10,13H2,1-2H3,(H2,27,31)(H,30,33)/q-1 |
| InChIKey | REDOXGPAFKNPMY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|