About CID 138459311
CID 138459311 (PubChem CID 138459311) has the molecular formula C22H25F4N6O3S-
and a molecular weight of 529.54 g/mol.
Molecular Properties
| Compound Name | CID 138459311 |
| PubChem CID | 138459311 |
| Molecular Formula | C22H25F4N6O3S- |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | — |
| SMILES | CC(C)(/N=C(\N)N1CCCCN=[S-]1=O)c1cc(NC(=O)c2ccc(OCC(F)(F)F)cn2)ccc1F |
| InChI | InChI=1S/C22H25F4N6O3S/c1-21(2,31-20(27)32-10-4-3-9-29-36(32)34)16-11-14(5-7-17(16)23)30-19(33)18-8-6-15(12-28-18)35-13-22(24,25)26/h5-8,11-12H,3-4,9-10,13H2,1-2H3,(H2,27,31)(H,30,33)/q-1 |
| InChIKey | REDOXGPAFKNPMY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 138459311 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138459311?
The IUPAC name of CID 138459311 (CID 138459311) is not available.
What is the SMILES notation for CID 138459311?
The canonical SMILES for CID 138459311 is CC(C)(/N=C(\N)N1CCCCN=[S-]1=O)c1cc(NC(=O)c2ccc(OCC(F)(F)F)cn2)ccc1F.
What is the InChIKey of CID 138459311?
The InChIKey is REDOXGPAFKNPMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25F4N6O3S/c1-21(2,31-20(27)32-10-4-3-9-29-36(32)34)16-11-14(5-7-17(16)23)30-19(33)18-8-6-15(12-28-18)35-13-22(24,25)26/h5-8,11-12H,3-4,9-10,13H2,1-2H3,(H2,27,31)(H,30,33)/q-1.
What are the key properties of CID 138459311?
CID 138459311 has a molecular weight of 529.54 g/mol, XLogP of 4.12, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138459311 is sourced from PubChem (CID 138459311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).