C20H28N2O3S — CID 138466614
N,N-ditert-butyl-3-(3-cyanocyclobutyl)sulfonylbenzamide (PubChem CID 138466614) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is N,N-ditert-butyl-3-(3-cyanocyclobutyl)sulfonylbenzamide.
| Compound Name | N,N-ditert-butyl-3-(3-cyanocyclobutyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 138466614 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N,N-ditert-butyl-3-(3-cyanocyclobutyl)sulfonylbenzamide |
| SMILES | CC(C)(C)N(C(=O)c1cccc(S(=O)(=O)C2CC(C#N)C2)c1)C(C)(C)C |
| InChI | InChI=1S/C20H28N2O3S/c1-19(2,3)22(20(4,5)6)18(23)15-8-7-9-16(12-15)26(24,25)17-10-14(11-17)13-21/h7-9,12,14,17H,10-11H2,1-6H3 |
| InChIKey | PATKWOUNTZMNEA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |