C39H64O5 — CID 138472714
2,3-dihydroxypropyl (11Z,14Z,17Z)-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienyl]-3-oxoicosa-11,14,17-trienoate (PubChem CID 138472714) has the molecular formula C39H64O5 and a molecular weight of 612.94 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (11Z,14Z,17Z)-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienyl]-3-oxoicosa-11,14,17-trienoate.
| Compound Name | 2,3-dihydroxypropyl (11Z,14Z,17Z)-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienyl]-3-oxoicosa-11,14,17-trienoate |
|---|---|
| PubChem CID | 138472714 |
| Molecular Formula | C39H64O5 |
| Molecular Weight | 612.94 g/mol |
| Exact Mass | 612.48 |
| IUPAC Name | 2,3-dihydroxypropyl (11Z,14Z,17Z)-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienyl]-3-oxoicosa-11,14,17-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)C(CCCCCC/C=C\C/C=C\C/C=C\CC)C(=O)OCC(O)CO |
| InChI | InChI=1S/C39H64O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(42)37(39(43)44-35-36(41)34-40)32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,36-37,40-41H,3-4,9-10,15-16,21-35H2,1-2H3/b7-5-,8-6-,13-11-,14-12-,19-17-,20-18- |
| InChIKey | AQYDWFWHUFUMSQ-YTWBPVBXSA-N |
| XLogP | 9.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.94 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|