C30H31N3O7S — CID 138482154
[(3R)-9,12-dioxo-2-[(2S)-8-thiatricyclo[11.3.1.13,7]octadeca-1(16),3(18),4,6,13(17),14-hexaen-2-yl]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate (PubChem CID 138482154) has the molecular formula C30H31N3O7S and a molecular weight of 577.66 g/mol. Its IUPAC name is [(3R)-9,12-dioxo-2-[(2S)-8-thiatricyclo[11.3.1.13,7]octadeca-1(16),3(18),4,6,13(17),14-hexaen-2-yl]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [(3R)-9,12-dioxo-2-[(2S)-8-thiatricyclo[11.3.1.13,7]octadeca-1(16),3(18),4,6,13(17),14-hexaen-2-yl]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 138482154 |
| Molecular Formula | C30H31N3O7S |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.19 |
| IUPAC Name | [(3R)-9,12-dioxo-2-[(2S)-8-thiatricyclo[11.3.1.13,7]octadeca-1(16),3(18),4,6,13(17),14-hexaen-2-yl]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N([C@H]1c3cccc(c3)CCCCSc3cccc1c3)[C@@H]1COCCN1C2=O |
| InChI | InChI=1S/C30H31N3O7S/c1-37-30(36)40-19-39-28-24(34)11-12-32-27(28)29(35)31-13-14-38-18-25(31)33(32)26-21-8-4-7-20(16-21)6-2-3-15-41-23-10-5-9-22(26)17-23/h4-5,7-12,16-17,25-26H,2-3,6,13-15,18-19H2,1H3/t25-,26+/m1/s1 |
| InChIKey | ROJIAHAJRIIDLI-FTJBHMTQSA-N |
| XLogP | 3.94 |
| TPSA | 99.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|