C27H33NO3 — CID 138493132
4-[(E)-1-[4-[2-(aziridin-1-yl)ethoxy]cyclohexa-2,4-dien-1-yl]-5-hydroxy-2-phenylpent-1-enyl]cyclohexa-2,4-dien-1-ol (PubChem CID 138493132) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 4-[(E)-1-[4-[2-(aziridin-1-yl)ethoxy]cyclohexa-2,4-dien-1-yl]-5-hydroxy-2-phenylpent-1-enyl]cyclohexa-2,4-dien-1-ol.
| Compound Name | 4-[(E)-1-[4-[2-(aziridin-1-yl)ethoxy]cyclohexa-2,4-dien-1-yl]-5-hydroxy-2-phenylpent-1-enyl]cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 138493132 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 4-[(E)-1-[4-[2-(aziridin-1-yl)ethoxy]cyclohexa-2,4-dien-1-yl]-5-hydroxy-2-phenylpent-1-enyl]cyclohexa-2,4-dien-1-ol |
| SMILES | OCCC/C(=C(\C1=CCC(O)C=C1)C1C=CC(OCCN2CC2)=CC1)c1ccccc1 |
| InChI | InChI=1S/C27H33NO3/c29-19-4-7-26(21-5-2-1-3-6-21)27(22-8-12-24(30)13-9-22)23-10-14-25(15-11-23)31-20-18-28-16-17-28/h1-3,5-6,8-10,12,14-15,23-24,29-30H,4,7,11,13,16-20H2/b27-26- |
| InChIKey | CROUUNLGVJBRET-RQZHXJHFSA-N |
| XLogP | 4.25 |
| TPSA | 52.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|