C30H35NO2 — CID 138493139
3-[(E)-1-[4-(1-cyclopropylpyrrolidin-3-yl)cyclohexa-2,4-dien-1-yl]-5-hydroxy-2-phenylpent-1-enyl]phenol (PubChem CID 138493139) has the molecular formula C30H35NO2 and a molecular weight of 441.62 g/mol. Its IUPAC name is 3-[(E)-1-[4-(1-cyclopropylpyrrolidin-3-yl)cyclohexa-2,4-dien-1-yl]-5-hydroxy-2-phenylpent-1-enyl]phenol.
| Compound Name | 3-[(E)-1-[4-(1-cyclopropylpyrrolidin-3-yl)cyclohexa-2,4-dien-1-yl]-5-hydroxy-2-phenylpent-1-enyl]phenol |
|---|---|
| PubChem CID | 138493139 |
| Molecular Formula | C30H35NO2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 3-[(E)-1-[4-(1-cyclopropylpyrrolidin-3-yl)cyclohexa-2,4-dien-1-yl]-5-hydroxy-2-phenylpent-1-enyl]phenol |
| SMILES | OCCC/C(=C(\c1cccc(O)c1)C1C=CC(C2CCN(C3CC3)C2)=CC1)c1ccccc1 |
| InChI | InChI=1S/C30H35NO2/c32-19-5-10-29(23-6-2-1-3-7-23)30(25-8-4-9-28(33)20-25)24-13-11-22(12-14-24)26-17-18-31(21-26)27-15-16-27/h1-4,6-9,11-13,20,24,26-27,32-33H,5,10,14-19,21H2/b30-29+ |
| InChIKey | NDRNALKYZJFIRT-QVIHXGFCSA-N |
| XLogP | 6.06 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|