C29H33NO2 — CID 138614647
4-[(Z)-1-[4-(1-cyclopropylazetidin-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]cyclohexa-1,5-dien-1-ol (PubChem CID 138614647) has the molecular formula C29H33NO2 and a molecular weight of 427.59 g/mol. Its IUPAC name is 4-[(Z)-1-[4-(1-cyclopropylazetidin-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]cyclohexa-1,5-dien-1-ol.
| Compound Name | 4-[(Z)-1-[4-(1-cyclopropylazetidin-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]cyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 138614647 |
| Molecular Formula | C29H33NO2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 4-[(Z)-1-[4-(1-cyclopropylazetidin-3-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]cyclohexa-1,5-dien-1-ol |
| SMILES | OCCC/C(=C(/c1ccc(C2CN(C3CC3)C2)cc1)C1C=CC(O)=CC1)c1ccccc1 |
| InChI | InChI=1S/C29H33NO2/c31-18-4-7-28(22-5-2-1-3-6-22)29(24-12-16-27(32)17-13-24)23-10-8-21(9-11-23)25-19-30(20-25)26-14-15-26/h1-3,5-6,8-12,16-17,24-26,31-32H,4,7,13-15,18-20H2/b29-28+ |
| InChIKey | XUIDPBSMIYICII-ZQHSETAFSA-N |
| XLogP | 5.95 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|