C32H37NO2 — CID 138614606
3-[(4E,7Z,9E)-9-(1-cyclopropyl-3,6-dihydro-2H-pyridin-4-yl)-1-hydroxy-6-methylidene-4-phenylundeca-4,7,9-trien-5-yl]phenol (PubChem CID 138614606) has the molecular formula C32H37NO2 and a molecular weight of 467.65 g/mol. Its IUPAC name is 3-[(4E,7Z,9E)-9-(1-cyclopropyl-3,6-dihydro-2H-pyridin-4-yl)-1-hydroxy-6-methylidene-4-phenylundeca-4,7,9-trien-5-yl]phenol.
| Compound Name | 3-[(4E,7Z,9E)-9-(1-cyclopropyl-3,6-dihydro-2H-pyridin-4-yl)-1-hydroxy-6-methylidene-4-phenylundeca-4,7,9-trien-5-yl]phenol |
|---|---|
| PubChem CID | 138614606 |
| Molecular Formula | C32H37NO2 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 3-[(4E,7Z,9E)-9-(1-cyclopropyl-3,6-dihydro-2H-pyridin-4-yl)-1-hydroxy-6-methylidene-4-phenylundeca-4,7,9-trien-5-yl]phenol |
| SMILES | C=C(/C=C\C(=C/C)C1=CCN(C2CC2)CC1)/C(=C(/CCCO)c1ccccc1)c1cccc(O)c1 |
| InChI | InChI=1S/C32H37NO2/c1-3-25(26-18-20-33(21-19-26)29-16-17-29)15-14-24(2)32(28-11-7-12-30(35)23-28)31(13-8-22-34)27-9-5-4-6-10-27/h3-7,9-12,14-15,18,23,29,34-35H,2,8,13,16-17,19-22H2,1H3/b15-14-,25-3+,32-31+ |
| InChIKey | WFYJAYVNLTYOCQ-XSTDBDQSSA-N |
| XLogP | 6.93 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|