C14H14N2O2 — CID 144911407
(4-hydroxycyclohexa-1,5-diene-1-carboximidoyl) benzenecarboximidate (PubChem CID 144911407) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is (4-hydroxycyclohexa-1,5-diene-1-carboximidoyl) benzenecarboximidate.
| Compound Name | (4-hydroxycyclohexa-1,5-diene-1-carboximidoyl) benzenecarboximidate |
|---|---|
| PubChem CID | 144911407 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (4-hydroxycyclohexa-1,5-diene-1-carboximidoyl) benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccccc1)C1=CCC(O)C=C1 |
| InChI | InChI=1S/C14H14N2O2/c15-13(10-4-2-1-3-5-10)18-14(16)11-6-8-12(17)9-7-11/h1-8,12,15-17H,9H2/b15-13+,16-14- |
| InChIKey | MDPSJZLTQIRYRR-ZNOBWPMYSA-N |
| XLogP | 2.25 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|