C21H21N — CID 138495122
N-[(1E)-buta-1,3-dienyl]-N-phenyl-8,9-dihydro-7H-benzo[7]annulen-9-amine (PubChem CID 138495122) has the molecular formula C21H21N and a molecular weight of 287.41 g/mol. Its IUPAC name is N-[(1E)-buta-1,3-dienyl]-N-phenyl-8,9-dihydro-7H-benzo[7]annulen-9-amine.
| Compound Name | N-[(1E)-buta-1,3-dienyl]-N-phenyl-8,9-dihydro-7H-benzo[7]annulen-9-amine |
|---|---|
| PubChem CID | 138495122 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[(1E)-buta-1,3-dienyl]-N-phenyl-8,9-dihydro-7H-benzo[7]annulen-9-amine |
| SMILES | C=C/C=C/N(c1ccccc1)C1CCC=Cc2ccccc21 |
| InChI | InChI=1S/C21H21N/c1-2-3-17-22(19-13-5-4-6-14-19)21-16-10-8-12-18-11-7-9-15-20(18)21/h2-9,11-15,17,21H,1,10,16H2/b17-3+ |
| InChIKey | VKAKKYQRBYDGLT-IJUHEHPCSA-N |
| XLogP | 5.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|