C13H18N2 — CID 138502158
4-[(2E,4E)-5-amino-2-methylhexa-2,4-dienyl]aniline (PubChem CID 138502158) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-[(2E,4E)-5-amino-2-methylhexa-2,4-dienyl]aniline.
| Compound Name | 4-[(2E,4E)-5-amino-2-methylhexa-2,4-dienyl]aniline |
|---|---|
| PubChem CID | 138502158 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 4-[(2E,4E)-5-amino-2-methylhexa-2,4-dienyl]aniline |
| SMILES | C/C(N)=C\C=C(/C)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C13H18N2/c1-10(3-4-11(2)14)9-12-5-7-13(15)8-6-12/h3-8H,9,14-15H2,1-2H3/b10-3+,11-4+ |
| InChIKey | MSGYATUNYYNUCL-HULALXFYSA-N |
| XLogP | 2.62 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|