C12H16N2O2S — CID 139571336
4-[(2E,4E)-5-aminohexa-2,4-dien-2-yl]sulfonylaniline (PubChem CID 139571336) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 4-[(2E,4E)-5-aminohexa-2,4-dien-2-yl]sulfonylaniline.
| Compound Name | 4-[(2E,4E)-5-aminohexa-2,4-dien-2-yl]sulfonylaniline |
|---|---|
| PubChem CID | 139571336 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-[(2E,4E)-5-aminohexa-2,4-dien-2-yl]sulfonylaniline |
| SMILES | C/C(N)=C\C=C(/C)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H16N2O2S/c1-9(13)3-4-10(2)17(15,16)12-7-5-11(14)6-8-12/h3-8H,13-14H2,1-2H3/b9-3+,10-4+ |
| InChIKey | ACTBDOQVPMQHNG-LQIBPGRFSA-N |
| XLogP | 1.81 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|