C10H12ClNO2 — CID 138524012
2-chloro-3-(1,3-dioxolan-2-yl)-5,6-dimethylpyridine (PubChem CID 138524012) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is 2-chloro-3-(1,3-dioxolan-2-yl)-5,6-dimethylpyridine.
| Compound Name | 2-chloro-3-(1,3-dioxolan-2-yl)-5,6-dimethylpyridine |
|---|---|
| PubChem CID | 138524012 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-chloro-3-(1,3-dioxolan-2-yl)-5,6-dimethylpyridine |
| SMILES | Cc1cc(C2OCCO2)c(Cl)nc1C |
| InChI | InChI=1S/C10H12ClNO2/c1-6-5-8(9(11)12-7(6)2)10-13-3-4-14-10/h5,10H,3-4H2,1-2H3 |
| InChIKey | NMFNDJGDWLVLPN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|