C9H8Cl3NO2 — CID 168877264
2,4,6-trichloro-3-(1,3-dioxan-2-yl)pyridine (PubChem CID 168877264) has the molecular formula C9H8Cl3NO2 and a molecular weight of 268.53 g/mol. Its IUPAC name is 2,4,6-trichloro-3-(1,3-dioxan-2-yl)pyridine.
| Compound Name | 2,4,6-trichloro-3-(1,3-dioxan-2-yl)pyridine |
|---|---|
| PubChem CID | 168877264 |
| Molecular Formula | C9H8Cl3NO2 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 266.96 |
| IUPAC Name | 2,4,6-trichloro-3-(1,3-dioxan-2-yl)pyridine |
| SMILES | Clc1cc(Cl)c(C2OCCCO2)c(Cl)n1 |
| InChI | InChI=1S/C9H8Cl3NO2/c10-5-4-6(11)13-8(12)7(5)9-14-2-1-3-15-9/h4,9H,1-3H2 |
| InChIKey | UNWSFYJZXCWYEL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|