C32H32N2O8 — CID 138527211
[6-[1-[4-(2,5-dioxopyrrol-1-yl)phenyl]-2-methyl-1-oxopropan-2-yl]oxy-2-methylhexan-2-yl] 4-(2,5-dioxopyrrol-1-yl)benzoate (PubChem CID 138527211) has the molecular formula C32H32N2O8 and a molecular weight of 572.61 g/mol. Its IUPAC name is [6-[1-[4-(2,5-dioxopyrrol-1-yl)phenyl]-2-methyl-1-oxopropan-2-yl]oxy-2-methylhexan-2-yl] 4-(2,5-dioxopyrrol-1-yl)benzoate.
| Compound Name | [6-[1-[4-(2,5-dioxopyrrol-1-yl)phenyl]-2-methyl-1-oxopropan-2-yl]oxy-2-methylhexan-2-yl] 4-(2,5-dioxopyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 138527211 |
| Molecular Formula | C32H32N2O8 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | [6-[1-[4-(2,5-dioxopyrrol-1-yl)phenyl]-2-methyl-1-oxopropan-2-yl]oxy-2-methylhexan-2-yl] 4-(2,5-dioxopyrrol-1-yl)benzoate |
| SMILES | CC(C)(CCCCOC(C)(C)C(=O)c1ccc(N2C(=O)C=CC2=O)cc1)OC(=O)c1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C32H32N2O8/c1-31(2,42-30(40)22-9-13-24(14-10-22)34-27(37)17-18-28(34)38)19-5-6-20-41-32(3,4)29(39)21-7-11-23(12-8-21)33-25(35)15-16-26(33)36/h7-18H,5-6,19-20H2,1-4H3 |
| InChIKey | YDQLHQQQALRAIK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|