C13H22O3 — CID 138527484
(Z)-3-(3,3-dimethylbutoxymethyl)-2-methyl-4-oxopent-2-enal (PubChem CID 138527484) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (Z)-3-(3,3-dimethylbutoxymethyl)-2-methyl-4-oxopent-2-enal.
| Compound Name | (Z)-3-(3,3-dimethylbutoxymethyl)-2-methyl-4-oxopent-2-enal |
|---|---|
| PubChem CID | 138527484 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (Z)-3-(3,3-dimethylbutoxymethyl)-2-methyl-4-oxopent-2-enal |
| SMILES | CC(=O)/C(COCCC(C)(C)C)=C(/C)C=O |
| InChI | InChI=1S/C13H22O3/c1-10(8-14)12(11(2)15)9-16-7-6-13(3,4)5/h8H,6-7,9H2,1-5H3/b12-10- |
| InChIKey | MWHCPEGGUFEPEZ-BENRWUELSA-N |
| XLogP | 2.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|