C42H64O4 — CID 138529438
2-[1-[3-ethyl-4-[4-[4-(2-ethyl-4-pentylphenyl)cyclohexyl]cyclohexyl]phenyl]-4-methoxybutoxy]ethyl acetate (PubChem CID 138529438) has the molecular formula C42H64O4 and a molecular weight of 632.97 g/mol. Its IUPAC name is 2-[1-[3-ethyl-4-[4-[4-(2-ethyl-4-pentylphenyl)cyclohexyl]cyclohexyl]phenyl]-4-methoxybutoxy]ethyl acetate.
| Compound Name | 2-[1-[3-ethyl-4-[4-[4-(2-ethyl-4-pentylphenyl)cyclohexyl]cyclohexyl]phenyl]-4-methoxybutoxy]ethyl acetate |
|---|---|
| PubChem CID | 138529438 |
| Molecular Formula | C42H64O4 |
| Molecular Weight | 632.97 g/mol |
| Exact Mass | 632.48 |
| IUPAC Name | 2-[1-[3-ethyl-4-[4-[4-(2-ethyl-4-pentylphenyl)cyclohexyl]cyclohexyl]phenyl]-4-methoxybutoxy]ethyl acetate |
| SMILES | CCCCCc1ccc(C2CCC(C3CCC(c4ccc(C(CCCOC)OCCOC(C)=O)cc4CC)CC3)CC2)c(CC)c1 |
| InChI | InChI=1S/C42H64O4/c1-6-9-10-12-32-14-24-40(33(7-2)29-32)37-19-15-35(16-20-37)36-17-21-38(22-18-36)41-25-23-39(30-34(41)8-3)42(13-11-26-44-5)46-28-27-45-31(4)43/h14,23-25,29-30,35-38,42H,6-13,15-22,26-28H2,1-5H3 |
| InChIKey | VHJVIPPRBJRCDO-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.97 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|