C39H39ClN8O5 — CID 138542919
4-[4-[4-[4-[5-chloro-4-(1-oxo-2,8-diazaspiro[4.5]decan-8-yl)-3-pyridinyl]phenyl]pyrazol-1-yl]butylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 138542919) has the molecular formula C39H39ClN8O5 and a molecular weight of 735.24 g/mol. Its IUPAC name is 4-[4-[4-[4-[5-chloro-4-(1-oxo-2,8-diazaspiro[4.5]decan-8-yl)-3-pyridinyl]phenyl]pyrazol-1-yl]butylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[4-[4-[4-[5-chloro-4-(1-oxo-2,8-diazaspiro[4.5]decan-8-yl)-3-pyridinyl]phenyl]pyrazol-1-yl]butylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 138542919 |
| Molecular Formula | C39H39ClN8O5 |
| Molecular Weight | 735.24 g/mol |
| Exact Mass | 734.27 |
| IUPAC Name | 4-[4-[4-[4-[5-chloro-4-(1-oxo-2,8-diazaspiro[4.5]decan-8-yl)-3-pyridinyl]phenyl]pyrazol-1-yl]butylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCn4cc(-c5ccc(-c6cncc(Cl)c6N6CCC7(CCNC7=O)CC6)cc5)cn4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C39H39ClN8O5/c40-29-22-41-21-28(34(29)46-18-13-39(14-19-46)12-16-43-38(39)53)25-8-6-24(7-9-25)26-20-44-47(23-26)17-2-1-15-42-30-5-3-4-27-33(30)37(52)48(36(27)51)31-10-11-32(49)45-35(31)50/h3-9,20-23,31,42H,1-2,10-19H2,(H,43,53)(H,45,49,50) |
| InChIKey | YSXDVUXVDABBBG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 158.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.24 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|