C21H34N4O2 — CID 138544466
7-(1,4-dioxaspiro[4.5]decan-8-yl)-N-[(2S)-heptan-2-yl]-1,4-dihydropyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 138544466) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 7-(1,4-dioxaspiro[4.5]decan-8-yl)-N-[(2S)-heptan-2-yl]-1,4-dihydropyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 7-(1,4-dioxaspiro[4.5]decan-8-yl)-N-[(2S)-heptan-2-yl]-1,4-dihydropyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 138544466 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 7-(1,4-dioxaspiro[4.5]decan-8-yl)-N-[(2S)-heptan-2-yl]-1,4-dihydropyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | CCCCC[C@H](C)NC1=NCc2ccc(C3CCC4(CC3)OCCO4)n2N1 |
| InChI | InChI=1S/C21H34N4O2/c1-3-4-5-6-16(2)23-20-22-15-18-7-8-19(25(18)24-20)17-9-11-21(12-10-17)26-13-14-27-21/h7-8,16-17H,3-6,9-15H2,1-2H3,(H2,22,23,24)/t16-/m0/s1 |
| InChIKey | YFMRQYICUPBDGQ-INIZCTEOSA-N |
| XLogP | 3.86 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|