C18H29FN2 — CID 138563992
(3E,5Z)-5-ethyl-8-fluoro-4-N-methyl-4-N-[(E)-4-methylidenehex-1-enyl]octa-1,3,5-triene-2,4-diamine (PubChem CID 138563992) has the molecular formula C18H29FN2 and a molecular weight of 292.44 g/mol. Its IUPAC name is (3E,5Z)-5-ethyl-8-fluoro-4-N-methyl-4-N-[(E)-4-methylidenehex-1-enyl]octa-1,3,5-triene-2,4-diamine.
| Compound Name | (3E,5Z)-5-ethyl-8-fluoro-4-N-methyl-4-N-[(E)-4-methylidenehex-1-enyl]octa-1,3,5-triene-2,4-diamine |
|---|---|
| PubChem CID | 138563992 |
| Molecular Formula | C18H29FN2 |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | (3E,5Z)-5-ethyl-8-fluoro-4-N-methyl-4-N-[(E)-4-methylidenehex-1-enyl]octa-1,3,5-triene-2,4-diamine |
| SMILES | C=C(N)/C=C(C(=C/CCF)\CC)/N(C)/C=C/CC(=C)CC |
| InChI | InChI=1S/C18H29FN2/c1-6-15(3)10-9-13-21(5)18(14-16(4)20)17(7-2)11-8-12-19/h9,11,13-14H,3-4,6-8,10,12,20H2,1-2,5H3/b13-9+,17-11-,18-14+ |
| InChIKey | LVEVEWMTNYNVNO-HESAXARBSA-N |
| XLogP | 4.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|