C22H26F3N3O3 — CID 138567596
3-(ethylamino)-N-(3-methoxypropyl)-4-[C-methyl-N-[4-(trifluoromethoxy)phenyl]carbonimidoyl]benzamide (PubChem CID 138567596) has the molecular formula C22H26F3N3O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is 3-(ethylamino)-N-(3-methoxypropyl)-4-[C-methyl-N-[4-(trifluoromethoxy)phenyl]carbonimidoyl]benzamide.
| Compound Name | 3-(ethylamino)-N-(3-methoxypropyl)-4-[C-methyl-N-[4-(trifluoromethoxy)phenyl]carbonimidoyl]benzamide |
|---|---|
| PubChem CID | 138567596 |
| Molecular Formula | C22H26F3N3O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 3-(ethylamino)-N-(3-methoxypropyl)-4-[C-methyl-N-[4-(trifluoromethoxy)phenyl]carbonimidoyl]benzamide |
| SMILES | CCNc1cc(C(=O)NCCCOC)ccc1/C(C)=N/c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H26F3N3O3/c1-4-26-20-14-16(21(29)27-12-5-13-30-3)6-11-19(20)15(2)28-17-7-9-18(10-8-17)31-22(23,24)25/h6-11,14,26H,4-5,12-13H2,1-3H3,(H,27,29)/b28-15+ |
| InChIKey | HGCJWPQDERUWRY-RWPZCVJISA-N |
| XLogP | 4.92 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|