C15H18FN3O3 — CID 138567887
tert-butyl N-[4-[5-fluoro-6-[(E)-hydroxyiminomethyl]-2-pyridinyl]but-3-ynyl]carbamate (PubChem CID 138567887) has the molecular formula C15H18FN3O3 and a molecular weight of 307.32 g/mol. Its IUPAC name is tert-butyl N-[4-[5-fluoro-6-[(E)-hydroxyiminomethyl]-2-pyridinyl]but-3-ynyl]carbamate.
| Compound Name | tert-butyl N-[4-[5-fluoro-6-[(E)-hydroxyiminomethyl]-2-pyridinyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 138567887 |
| Molecular Formula | C15H18FN3O3 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | tert-butyl N-[4-[5-fluoro-6-[(E)-hydroxyiminomethyl]-2-pyridinyl]but-3-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC#Cc1ccc(F)c(/C=N/O)n1 |
| InChI | InChI=1S/C15H18FN3O3/c1-15(2,3)22-14(20)17-9-5-4-6-11-7-8-12(16)13(19-11)10-18-21/h7-8,10,21H,5,9H2,1-3H3,(H,17,20)/b18-10+ |
| InChIKey | NXZYSLVFQUJHCF-VCHYOVAHSA-N |
| XLogP | 2.30 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|