C18H32N2O3S — CID 138568254
[2-methyl-4-[2-methyl-5-(4-methylpent-2-ynylamino)-5-oxopentan-2-yl]oxybutan-2-yl]carbamothioic S-acid (PubChem CID 138568254) has the molecular formula C18H32N2O3S and a molecular weight of 356.53 g/mol. Its IUPAC name is [2-methyl-4-[2-methyl-5-(4-methylpent-2-ynylamino)-5-oxopentan-2-yl]oxybutan-2-yl]carbamothioic S-acid.
| Compound Name | [2-methyl-4-[2-methyl-5-(4-methylpent-2-ynylamino)-5-oxopentan-2-yl]oxybutan-2-yl]carbamothioic S-acid |
|---|---|
| PubChem CID | 138568254 |
| Molecular Formula | C18H32N2O3S |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | [2-methyl-4-[2-methyl-5-(4-methylpent-2-ynylamino)-5-oxopentan-2-yl]oxybutan-2-yl]carbamothioic S-acid |
| SMILES | CC(C)C#CCNC(=O)CCC(C)(C)OCCC(C)(C)NC(=O)S |
| InChI | InChI=1S/C18H32N2O3S/c1-14(2)8-7-12-19-15(21)9-10-18(5,6)23-13-11-17(3,4)20-16(22)24/h14H,9-13H2,1-6H3,(H,19,21)(H2,20,22,24) |
| InChIKey | QEXGJQOJWCWQQE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|