C19H36N2O3S — CID 138568252
[4-[4-[[(E)-4,5-dimethylhex-2-enoyl]amino]-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl]carbamothioic S-acid (PubChem CID 138568252) has the molecular formula C19H36N2O3S and a molecular weight of 372.58 g/mol. Its IUPAC name is [4-[4-[[(E)-4,5-dimethylhex-2-enoyl]amino]-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl]carbamothioic S-acid.
| Compound Name | [4-[4-[[(E)-4,5-dimethylhex-2-enoyl]amino]-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl]carbamothioic S-acid |
|---|---|
| PubChem CID | 138568252 |
| Molecular Formula | C19H36N2O3S |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | [4-[4-[[(E)-4,5-dimethylhex-2-enoyl]amino]-2-methylbutan-2-yl]oxy-2-methylbutan-2-yl]carbamothioic S-acid |
| SMILES | CC(C)C(C)/C=C/C(=O)NCCC(C)(C)OCCC(C)(C)NC(=O)S |
| InChI | InChI=1S/C19H36N2O3S/c1-14(2)15(3)8-9-16(22)20-12-10-19(6,7)24-13-11-18(4,5)21-17(23)25/h8-9,14-15H,10-13H2,1-7H3,(H,20,22)(H2,21,23,25)/b9-8+ |
| InChIKey | KDQUIFYPTFLMFK-CMDGGOBGSA-N |
| XLogP | 3.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|