C22H25FN4OS — CID 138572133
N-[4-[4-(ethylsulfanylamino)-3-fluorophenyl]-1-propylpyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide (PubChem CID 138572133) has the molecular formula C22H25FN4OS and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[4-[4-(ethylsulfanylamino)-3-fluorophenyl]-1-propylpyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide.
| Compound Name | N-[4-[4-(ethylsulfanylamino)-3-fluorophenyl]-1-propylpyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 138572133 |
| Molecular Formula | C22H25FN4OS |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[4-[4-(ethylsulfanylamino)-3-fluorophenyl]-1-propylpyrrolo[2,3-b]pyridin-6-yl]cyclopropanecarboxamide |
| SMILES | CCCn1ccc2c(-c3ccc(NSCC)c(F)c3)cc(NC(=O)C3CC3)nc21 |
| InChI | InChI=1S/C22H25FN4OS/c1-3-10-27-11-9-16-17(15-7-8-19(18(23)12-15)26-29-4-2)13-20(24-21(16)27)25-22(28)14-5-6-14/h7-9,11-14,26H,3-6,10H2,1-2H3,(H,24,25,28) |
| InChIKey | IMAORXPKFSNVCT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|