C22H35NS — CID 138615109
(2E,6Z,8Z)-1-[(Z)-but-2-enyl]sulfanyl-3-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methylundeca-2,6,8-trien-1-amine (PubChem CID 138615109) has the molecular formula C22H35NS and a molecular weight of 345.60 g/mol. Its IUPAC name is (2E,6Z,8Z)-1-[(Z)-but-2-enyl]sulfanyl-3-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methylundeca-2,6,8-trien-1-amine.
| Compound Name | (2E,6Z,8Z)-1-[(Z)-but-2-enyl]sulfanyl-3-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methylundeca-2,6,8-trien-1-amine |
|---|---|
| PubChem CID | 138615109 |
| Molecular Formula | C22H35NS |
| Molecular Weight | 345.60 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | (2E,6Z,8Z)-1-[(Z)-but-2-enyl]sulfanyl-3-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methylundeca-2,6,8-trien-1-amine |
| SMILES | C/C=C\CSC(N)/C=C(CC/C(C)=C\C=C/CC)/C(/C=C\C)=C/C |
| InChI | InChI=1S/C22H35NS/c1-6-10-12-14-19(5)15-16-21(20(9-4)13-8-3)18-22(23)24-17-11-7-2/h7-14,18,22H,6,15-17,23H2,1-5H3/b11-7-,12-10-,13-8-,19-14-,20-9+,21-18+ |
| InChIKey | NPCIZTBXBZDLEH-RQGCUZKFSA-N |
| XLogP | 6.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.60 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|